C25H51NO4P+ — CID 87063005
[(8Z,19Z)-2-hydroxy-2-phosphonodocosa-8,19-dienyl]-trimethylazanium (PubChem CID 87063005) has the molecular formula C25H51NO4P+ and a molecular weight of 460.66 g/mol. Its IUPAC name is [(8Z,19Z)-2-hydroxy-2-phosphonodocosa-8,19-dienyl]-trimethylazanium.
| Compound Name | [(8Z,19Z)-2-hydroxy-2-phosphonodocosa-8,19-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87063005 |
| Molecular Formula | C25H51NO4P+ |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | [(8Z,19Z)-2-hydroxy-2-phosphonodocosa-8,19-dienyl]-trimethylazanium |
| SMILES | CC/C=C\CCCCCCCCC/C=C\CCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C25H50NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(27,31(28,29)30)24-26(2,3)4/h6-7,17-18,27H,5,8-16,19-24H2,1-4H3,(H-,28,29,30)/p+1/b7-6-,18-17- |
| InChIKey | BFNLDUXSNVZUAM-BIGDMAPISA-O |
| XLogP | 6.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|