C21H43NO4P+ — CID 87062472
[(11Z,15Z)-2-hydroxy-2-phosphonooctadeca-11,15-dienyl]-trimethylazanium (PubChem CID 87062472) has the molecular formula C21H43NO4P+ and a molecular weight of 404.55 g/mol. Its IUPAC name is [(11Z,15Z)-2-hydroxy-2-phosphonooctadeca-11,15-dienyl]-trimethylazanium.
| Compound Name | [(11Z,15Z)-2-hydroxy-2-phosphonooctadeca-11,15-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062472 |
| Molecular Formula | C21H43NO4P+ |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(11Z,15Z)-2-hydroxy-2-phosphonooctadeca-11,15-dienyl]-trimethylazanium |
| SMILES | CC/C=C\CC/C=C\CCCCCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C21H42NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23,27(24,25)26)20-22(2,3)4/h6-7,10-11,23H,5,8-9,12-20H2,1-4H3,(H-,24,25,26)/p+1/b7-6-,11-10- |
| InChIKey | BFLTZMGQYBJDQX-QOXWLJPHSA-O |
| XLogP | 4.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|