C18H34N3O7P — CID 87064740
2-[[2-amino-5-[3-[cyclohexylmethyl(hydroxy)phosphoryl]propyl-hydroxyamino]-5-oxopentanoyl]amino]propanoic acid (PubChem CID 87064740) has the molecular formula C18H34N3O7P and a molecular weight of 435.46 g/mol. Its IUPAC name is 2-[[2-amino-5-[3-[cyclohexylmethyl(hydroxy)phosphoryl]propyl-hydroxyamino]-5-oxopentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-amino-5-[3-[cyclohexylmethyl(hydroxy)phosphoryl]propyl-hydroxyamino]-5-oxopentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87064740 |
| Molecular Formula | C18H34N3O7P |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-[[2-amino-5-[3-[cyclohexylmethyl(hydroxy)phosphoryl]propyl-hydroxyamino]-5-oxopentanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(N)CCC(=O)N(O)CCCP(=O)(O)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C18H34N3O7P/c1-13(18(24)25)20-17(23)15(19)8-9-16(22)21(26)10-5-11-29(27,28)12-14-6-3-2-4-7-14/h13-15,26H,2-12,19H2,1H3,(H,20,23)(H,24,25)(H,27,28) |
| InChIKey | SKGRVSQDUVFMAN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|