C16H31ClN2O2 — CID 87065238
2-(chloroamino)-N-[(E)-6-methoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide (PubChem CID 87065238) has the molecular formula C16H31ClN2O2 and a molecular weight of 318.89 g/mol. Its IUPAC name is 2-(chloroamino)-N-[(E)-6-methoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide.
| Compound Name | 2-(chloroamino)-N-[(E)-6-methoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 87065238 |
| Molecular Formula | C16H31ClN2O2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-(chloroamino)-N-[(E)-6-methoxy-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
| SMILES | COC/C(C)=C/C(C(C)C)N(C)C(=O)C(NCl)C(C)(C)C |
| InChI | InChI=1S/C16H31ClN2O2/c1-11(2)13(9-12(3)10-21-8)19(7)15(20)14(18-17)16(4,5)6/h9,11,13-14,18H,10H2,1-8H3/b12-9+ |
| InChIKey | PNKBUCNFRNEVTD-FMIVXFBMSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|