C16H18FNO3 — CID 87066473
tert-butyl N-[2-(4-fluorophenyl)pent-4-ynoyl]carbamate (PubChem CID 87066473) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is tert-butyl N-[2-(4-fluorophenyl)pent-4-ynoyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-fluorophenyl)pent-4-ynoyl]carbamate |
|---|---|
| PubChem CID | 87066473 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | tert-butyl N-[2-(4-fluorophenyl)pent-4-ynoyl]carbamate |
| SMILES | C#CCC(C(=O)NC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO3/c1-5-6-13(11-7-9-12(17)10-8-11)14(19)18-15(20)21-16(2,3)4/h1,7-10,13H,6H2,2-4H3,(H,18,19,20) |
| InChIKey | JXLWVQHUSSCKHM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|