C21H17F5N2O4 — CID 87066982
4-[4-(2,3,4,5,6-pentafluorophenoxy)carbonyl-2-[(Z)-prop-1-enyl]phenyl]piperazine-1-carboxylic acid (PubChem CID 87066982) has the molecular formula C21H17F5N2O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is 4-[4-(2,3,4,5,6-pentafluorophenoxy)carbonyl-2-[(Z)-prop-1-enyl]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(2,3,4,5,6-pentafluorophenoxy)carbonyl-2-[(Z)-prop-1-enyl]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87066982 |
| Molecular Formula | C21H17F5N2O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[4-(2,3,4,5,6-pentafluorophenoxy)carbonyl-2-[(Z)-prop-1-enyl]phenyl]piperazine-1-carboxylic acid |
| SMILES | C/C=C\c1cc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)ccc1N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C21H17F5N2O4/c1-2-3-11-10-12(4-5-13(11)27-6-8-28(9-7-27)21(30)31)20(29)32-19-17(25)15(23)14(22)16(24)18(19)26/h2-5,10H,6-9H2,1H3,(H,30,31)/b3-2- |
| InChIKey | QLJBQRUIHLIAAD-IHWYPQMZSA-N |
| XLogP | 4.43 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|