C18H32CoO2 — CID 87070026
cobalt;(9Z,12Z)-octadeca-9,12-dienoic acid (PubChem CID 87070026) has the molecular formula C18H32CoO2 and a molecular weight of 339.39 g/mol. Its IUPAC name is cobalt;(9Z,12Z)-octadeca-9,12-dienoic acid.
| Compound Name | cobalt;(9Z,12Z)-octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 87070026 |
| Molecular Formula | C18H32CoO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | cobalt;(9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.[Co] |
| InChI | InChI=1S/C18H32O2.Co/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);/b7-6-,10-9-; |
| InChIKey | RBDFAOAAVSWYPD-NBTZWHCOSA-N |
| XLogP | 5.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|