About dicyclopropylmethanolate;diethylalumanylium
dicyclopropylmethanolate;diethylalumanylium (PubChem CID 87070822) has the molecular formula C11H21AlO
and a molecular weight of 196.27 g/mol. Its IUPAC name is dicyclopropylmethanolate;diethylalumanylium.
Molecular Properties
| Compound Name | dicyclopropylmethanolate;diethylalumanylium |
| PubChem CID | 87070822 |
| Molecular Formula | C11H21AlO |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | dicyclopropylmethanolate;diethylalumanylium |
| SMILES | CC[Al+]CC.[O-]C(C1CC1)C1CC1 |
| InChI | InChI=1S/C7H11O.2C2H5.Al/c8-7(5-1-2-5)6-3-4-6;2*1-2;/h5-7H,1-4H2;2*1H2,2H3;/q-1;;;+1 |
| InChIKey | JVMDMZCZKZAAMY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dicyclopropylmethanolate;diethylalumanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclopropylmethanolate;diethylalumanylium?
The IUPAC name of dicyclopropylmethanolate;diethylalumanylium (CID 87070822) is dicyclopropylmethanolate;diethylalumanylium.
What is the SMILES notation for dicyclopropylmethanolate;diethylalumanylium?
The canonical SMILES for dicyclopropylmethanolate;diethylalumanylium is CC[Al+]CC.[O-]C(C1CC1)C1CC1.
What is the InChIKey of dicyclopropylmethanolate;diethylalumanylium?
The InChIKey is JVMDMZCZKZAAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O.2C2H5.Al/c8-7(5-1-2-5)6-3-4-6;2*1-2;/h5-7H,1-4H2;2*1H2,2H3;/q-1;;;+1.
What are the key properties of dicyclopropylmethanolate;diethylalumanylium?
dicyclopropylmethanolate;diethylalumanylium has a molecular weight of 196.27 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclopropylmethanolate;diethylalumanylium is sourced from PubChem (CID 87070822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).