C10H15NO3 — CID 87073400
N,N,1-trimethoxy-1-phenylmethanamine (PubChem CID 87073400) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N,N,1-trimethoxy-1-phenylmethanamine.
| Compound Name | N,N,1-trimethoxy-1-phenylmethanamine |
|---|---|
| PubChem CID | 87073400 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N,N,1-trimethoxy-1-phenylmethanamine |
| SMILES | COC(c1ccccc1)N(OC)OC |
| InChI | InChI=1S/C10H15NO3/c1-12-10(11(13-2)14-3)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | JFIUPACPLASBGN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|