C18H14N2O3S — CID 87074568
methyl 3-(2-amino-5-benzoyl-1,3-thiazol-4-yl)benzoate (PubChem CID 87074568) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 3-(2-amino-5-benzoyl-1,3-thiazol-4-yl)benzoate.
| Compound Name | methyl 3-(2-amino-5-benzoyl-1,3-thiazol-4-yl)benzoate |
|---|---|
| PubChem CID | 87074568 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 3-(2-amino-5-benzoyl-1,3-thiazol-4-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2nc(N)sc2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H14N2O3S/c1-23-17(22)13-9-5-8-12(10-13)14-16(24-18(19)20-14)15(21)11-6-3-2-4-7-11/h2-10H,1H3,(H2,19,20) |
| InChIKey | POONXQNTCZBFMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |