C17H23N3O8S2 — CID 87075161
2-[[2,3,3-trimethyl-4-(2-sulfoethylcarbamoyl)indole-6-carbonyl]amino]ethanesulfonic acid (PubChem CID 87075161) has the molecular formula C17H23N3O8S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[[2,3,3-trimethyl-4-(2-sulfoethylcarbamoyl)indole-6-carbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2,3,3-trimethyl-4-(2-sulfoethylcarbamoyl)indole-6-carbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87075161 |
| Molecular Formula | C17H23N3O8S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-[[2,3,3-trimethyl-4-(2-sulfoethylcarbamoyl)indole-6-carbonyl]amino]ethanesulfonic acid |
| SMILES | CC1=Nc2cc(C(=O)NCCS(=O)(=O)O)cc(C(=O)NCCS(=O)(=O)O)c2C1(C)C |
| InChI | InChI=1S/C17H23N3O8S2/c1-10-17(2,3)14-12(16(22)19-5-7-30(26,27)28)8-11(9-13(14)20-10)15(21)18-4-6-29(23,24)25/h8-9H,4-7H2,1-3H3,(H,18,21)(H,19,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | POESZPHPYODWMW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 179.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|