C9H9NO5S — CID 134285773
2-(7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carbonylamino)ethanesulfonic acid (PubChem CID 134285773) has the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carbonylamino)ethanesulfonic acid.
| Compound Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carbonylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 134285773 |
| Molecular Formula | C9H9NO5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carbonylamino)ethanesulfonic acid |
| SMILES | O=C(NCCS(=O)(=O)O)c1cc2ccc1o2 |
| InChI | InChI=1S/C9H9NO5S/c11-9(10-3-4-16(12,13)14)7-5-6-1-2-8(7)15-6/h1-2,5H,3-4H2,(H,10,11)(H,12,13,14) |
| InChIKey | HWJWIBYJKCLNMD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|