C25H21F3N2O3S — CID 87077827
(2S)-N-phenylmethoxy-3-[2-[4-(trifluoromethyl)phenyl]benzoyl]-1,3-thiazolidine-2-carboxamide (PubChem CID 87077827) has the molecular formula C25H21F3N2O3S and a molecular weight of 486.52 g/mol. Its IUPAC name is (2S)-N-phenylmethoxy-3-[2-[4-(trifluoromethyl)phenyl]benzoyl]-1,3-thiazolidine-2-carboxamide.
| Compound Name | (2S)-N-phenylmethoxy-3-[2-[4-(trifluoromethyl)phenyl]benzoyl]-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 87077827 |
| Molecular Formula | C25H21F3N2O3S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2S)-N-phenylmethoxy-3-[2-[4-(trifluoromethyl)phenyl]benzoyl]-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)[C@@H]1SCCN1C(=O)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F3N2O3S/c26-25(27,28)19-12-10-18(11-13-19)20-8-4-5-9-21(20)23(32)30-14-15-34-24(30)22(31)29-33-16-17-6-2-1-3-7-17/h1-13,24H,14-16H2,(H,29,31)/t24-/m0/s1 |
| InChIKey | UJVGEZSTZWBXQU-DEOSSOPVSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|