C28H29N5O3 — CID 91172577
(2S,3S)-3-azido-N-phenylmethoxy-1-[2-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 91172577) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2S,3S)-3-azido-N-phenylmethoxy-1-[2-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-3-azido-N-phenylmethoxy-1-[2-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91172577 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (2S,3S)-3-azido-N-phenylmethoxy-1-[2-(4-propylphenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCCc1ccc(-c2ccccc2C(=O)N2CC[C@H](N=[N+]=[N-])[C@H]2C(=O)NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N5O3/c1-2-8-20-13-15-22(16-14-20)23-11-6-7-12-24(23)28(35)33-18-17-25(30-32-29)26(33)27(34)31-36-19-21-9-4-3-5-10-21/h3-7,9-16,25-26H,2,8,17-19H2,1H3,(H,31,34)/t25-,26-/m0/s1 |
| InChIKey | LJXRXRGPEZKXSZ-UIOOFZCWSA-N |
| XLogP | 5.45 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|