About 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate
1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate (PubChem CID 23324392) has the molecular formula C31H31O2-
and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate.
Molecular Properties
| Compound Name | 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate |
| PubChem CID | 23324392 |
| Molecular Formula | C31H31O2- |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate |
| SMILES | CCCc1ccc(-c2ccccc2)cc1.CCCc1ccc(-c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H16O2.C15H16/c1-2-5-12-8-10-13(11-9-12)14-6-3-4-7-15(14)16(17)18;1-2-6-13-9-11-15(12-10-13)14-7-4-3-5-8-14/h3-4,6-11H,2,5H2,1H3,(H,17,18);3-5,7-12H,2,6H2,1H3/p-1 |
| InChIKey | GNNXXRLXGRTWKZ-UHFFFAOYSA-M |
| XLogP | 6.98 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate?
The IUPAC name of 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate (CID 23324392) is 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate.
What is the SMILES notation for 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate?
The canonical SMILES for 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate is CCCc1ccc(-c2ccccc2)cc1.CCCc1ccc(-c2ccccc2C(=O)[O-])cc1.
What is the InChIKey of 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate?
The InChIKey is GNNXXRLXGRTWKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16O2.C15H16/c1-2-5-12-8-10-13(11-9-12)14-6-3-4-7-15(14)16(17)18;1-2-6-13-9-11-15(12-10-13)14-7-4-3-5-8-14/h3-4,6-11H,2,5H2,1H3,(H,17,18);3-5,7-12H,2,6H2,1H3/p-1.
What are the key properties of 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate?
1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate has a molecular weight of 435.59 g/mol, XLogP of 6.98, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4-propylbenzene;2-(4-propylphenyl)benzoate is sourced from PubChem (CID 23324392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).