C31H25F3N2O4 — CID 57068636
[1-carbamoyl-2-[(3-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 57068636) has the molecular formula C31H25F3N2O4 and a molecular weight of 546.55 g/mol. Its IUPAC name is [1-carbamoyl-2-[(3-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [1-carbamoyl-2-[(3-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 57068636 |
| Molecular Formula | C31H25F3N2O4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | [1-carbamoyl-2-[(3-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | NC(=O)C1c2ccc(OC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2CCN1Cc1cccc(O)c1 |
| InChI | InChI=1S/C31H25F3N2O4/c32-31(33,34)22-10-8-20(9-11-22)25-6-1-2-7-27(25)30(39)40-24-12-13-26-21(17-24)14-15-36(28(26)29(35)38)18-19-4-3-5-23(37)16-19/h1-13,16-17,28,37H,14-15,18H2,(H2,35,38) |
| InChIKey | CQJMKJSYGLBNJR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|