C30H23ClF3NO2 — CID 67594535
[2-[(3-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 67594535) has the molecular formula C30H23ClF3NO2 and a molecular weight of 521.97 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-[(3-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 67594535 |
| Molecular Formula | C30H23ClF3NO2 |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [2-[(3-chlorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)CCN(Cc1cccc(Cl)c1)C2)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H23ClF3NO2/c31-25-5-3-4-20(16-25)18-35-15-14-22-17-26(13-10-23(22)19-35)37-29(36)28-7-2-1-6-27(28)21-8-11-24(12-9-21)30(32,33)34/h1-13,16-17H,14-15,18-19H2 |
| InChIKey | BAKIYQLZEDQZSP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|