C29H22F3NO3S — CID 67594492
[2-(2-thiophen-3-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 67594492) has the molecular formula C29H22F3NO3S and a molecular weight of 521.56 g/mol. Its IUPAC name is [2-(2-thiophen-3-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-(2-thiophen-3-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 67594492 |
| Molecular Formula | C29H22F3NO3S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | [2-(2-thiophen-3-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)CCN(C(=O)Cc1ccsc1)C2)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H22F3NO3S/c30-29(31,32)23-8-5-20(6-9-23)25-3-1-2-4-26(25)28(35)36-24-10-7-22-17-33(13-11-21(22)16-24)27(34)15-19-12-14-37-18-19/h1-10,12,14,16,18H,11,13,15,17H2 |
| InChIKey | KQMQJEVONGMRFM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|