C30H26F3N3O2 — CID 91078707
[6-(4-benzylpiperazin-1-yl)-3-pyridinyl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 91078707) has the molecular formula C30H26F3N3O2 and a molecular weight of 517.55 g/mol. Its IUPAC name is [6-(4-benzylpiperazin-1-yl)-3-pyridinyl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [6-(4-benzylpiperazin-1-yl)-3-pyridinyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 91078707 |
| Molecular Formula | C30H26F3N3O2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [6-(4-benzylpiperazin-1-yl)-3-pyridinyl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(Oc1ccc(N2CCN(Cc3ccccc3)CC2)nc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H26F3N3O2/c31-30(32,33)24-12-10-23(11-13-24)26-8-4-5-9-27(26)29(37)38-25-14-15-28(34-20-25)36-18-16-35(17-19-36)21-22-6-2-1-3-7-22/h1-15,20H,16-19,21H2 |
| InChIKey | XKGOAKITTLGTTK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |