C30H23F3N2O4 — CID 67593589
[2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 67593589) has the molecular formula C30H23F3N2O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is [2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 67593589 |
| Molecular Formula | C30H23F3N2O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | [2-[(3-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)CCN(Cc1cccc([N+](=O)[O-])c1)C2)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H23F3N2O4/c31-30(32,33)24-11-8-21(9-12-24)27-6-1-2-7-28(27)29(36)39-26-13-10-23-19-34(15-14-22(23)17-26)18-20-4-3-5-25(16-20)35(37)38/h1-13,16-17H,14-15,18-19H2 |
| InChIKey | BIBICJJWVSYVLL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|