C35H26F3NO3 — CID 67593744
[2-(2-naphthalen-2-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 67593744) has the molecular formula C35H26F3NO3 and a molecular weight of 565.59 g/mol. Its IUPAC name is [2-(2-naphthalen-2-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [2-(2-naphthalen-2-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 67593744 |
| Molecular Formula | C35H26F3NO3 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | [2-(2-naphthalen-2-ylacetyl)-3,4-dihydro-1H-isoquinolin-6-yl] 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(Oc1ccc2c(c1)CCN(C(=O)Cc1ccc3ccccc3c1)C2)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H26F3NO3/c36-35(37,38)29-14-11-25(12-15-29)31-7-3-4-8-32(31)34(41)42-30-16-13-28-22-39(18-17-27(28)21-30)33(40)20-23-9-10-24-5-1-2-6-26(24)19-23/h1-16,19,21H,17-18,20,22H2 |
| InChIKey | FOKZATYDRSEHIC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|