C10H20O4Si — CID 87077867
2,5-dimethyl-2-[1-(oxiran-2-ylmethoxy)ethyl]-1,3,2-dioxasilinane (PubChem CID 87077867) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is 2,5-dimethyl-2-[1-(oxiran-2-ylmethoxy)ethyl]-1,3,2-dioxasilinane.
| Compound Name | 2,5-dimethyl-2-[1-(oxiran-2-ylmethoxy)ethyl]-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 87077867 |
| Molecular Formula | C10H20O4Si |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2,5-dimethyl-2-[1-(oxiran-2-ylmethoxy)ethyl]-1,3,2-dioxasilinane |
| SMILES | CC1CO[Si](C)(C(C)OCC2CO2)OC1 |
| InChI | InChI=1S/C10H20O4Si/c1-8-4-13-15(3,14-5-8)9(2)11-6-10-7-12-10/h8-10H,4-7H2,1-3H3 |
| InChIKey | HRZNQCSYRZUYGZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|