C13H10N2O4S — CID 87078760
[2-[(5-formylthiophene-2-carbonyl)amino]phenyl]carbamic acid (PubChem CID 87078760) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is [2-[(5-formylthiophene-2-carbonyl)amino]phenyl]carbamic acid.
| Compound Name | [2-[(5-formylthiophene-2-carbonyl)amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87078760 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | [2-[(5-formylthiophene-2-carbonyl)amino]phenyl]carbamic acid |
| SMILES | O=Cc1ccc(C(=O)Nc2ccccc2NC(=O)O)s1 |
| InChI | InChI=1S/C13H10N2O4S/c16-7-8-5-6-11(20-8)12(17)14-9-3-1-2-4-10(9)15-13(18)19/h1-7,15H,(H,14,17)(H,18,19) |
| InChIKey | SFKKHSBALNEMBU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|