C54H68Si — CID 87083768
bis[8-(4-tert-butylphenyl)-2-(2-methylpropyl)-3,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane (PubChem CID 87083768) has the molecular formula C54H68Si and a molecular weight of 745.22 g/mol. Its IUPAC name is bis[8-(4-tert-butylphenyl)-2-(2-methylpropyl)-3,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane.
| Compound Name | bis[8-(4-tert-butylphenyl)-2-(2-methylpropyl)-3,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 87083768 |
| Molecular Formula | C54H68Si |
| Molecular Weight | 745.22 g/mol |
| Exact Mass | 744.51 |
| IUPAC Name | bis[8-(4-tert-butylphenyl)-2-(2-methylpropyl)-3,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
| SMILES | CC(C)CC1=C([Si](C)(C)C2=C(CC(C)C)Cc3cc4c(c(-c5ccc(C(C)(C)C)cc5)c32)CCC4)c2c(cc3c(c2-c2ccc(C(C)(C)C)cc2)CCC3)C1 |
| InChI | InChI=1S/C54H68Si/c1-33(2)27-41-31-39-29-37-15-13-17-45(37)47(35-19-23-43(24-20-35)53(5,6)7)49(39)51(41)55(11,12)52-42(28-34(3)4)32-40-30-38-16-14-18-46(38)48(50(40)52)36-21-25-44(26-22-36)54(8,9)10/h19-26,29-30,33-34H,13-18,27-28,31-32H2,1-12H3 |
| InChIKey | AGSZBCZKYVCEPI-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.22 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|