C30H26O6 — CID 101211605
4,8-bis(4-tert-butylphenyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 101211605) has the molecular formula C30H26O6 and a molecular weight of 482.53 g/mol. Its IUPAC name is 4,8-bis(4-tert-butylphenyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(4-tert-butylphenyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 101211605 |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4,8-bis(4-tert-butylphenyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | CC(C)(C)c1ccc(-c2c3c(=O)oc(=O)c3c(-c3ccc(C(C)(C)C)cc3)c3c(=O)oc(=O)c23)cc1 |
| InChI | InChI=1S/C30H26O6/c1-29(2,3)17-11-7-15(8-12-17)19-21-23(27(33)35-25(21)31)20(24-22(19)26(32)36-28(24)34)16-9-13-18(14-10-16)30(4,5)6/h7-14H,1-6H3 |
| InChIKey | DRBXFKGIVDNXNL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |