C40H46O2 — CID 122383670
3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 122383670) has the molecular formula C40H46O2 and a molecular weight of 558.81 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 122383670 |
| Molecular Formula | C40H46O2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(c(-c4c(O)c(-c5ccc(C(C)(C)C)cc5)cc5c4CCCC5)c2O)CCCC3)cc1 |
| InChI | InChI=1S/C40H46O2/c1-39(2,3)29-19-15-25(16-20-29)33-23-27-11-7-9-13-31(27)35(37(33)41)36-32-14-10-8-12-28(32)24-34(38(36)42)26-17-21-30(22-18-26)40(4,5)6/h15-24,41-42H,7-14H2,1-6H3 |
| InChIKey | IQGHFQRJCGFATR-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |