C34H34O6S2 — CID 122383674
1-[2-hydroxy-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 122383674) has the molecular formula C34H34O6S2 and a molecular weight of 602.77 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-[2-hydroxy-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 122383674 |
| Molecular Formula | C34H34O6S2 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 1-[2-hydroxy-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-3-(4-methylsulfonylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2cc3c(c(-c4c(O)c(-c5ccc(S(C)(=O)=O)cc5)cc5c4CCCC5)c2O)CCCC3)cc1 |
| InChI | InChI=1S/C34H34O6S2/c1-41(37,38)25-15-11-21(12-16-25)29-19-23-7-3-5-9-27(23)31(33(29)35)32-28-10-6-4-8-24(28)20-30(34(32)36)22-13-17-26(18-14-22)42(2,39)40/h11-20,35-36H,3-10H2,1-2H3 |
| InChIKey | GADBGUZVRJFHIK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |