C23H28O4S — CID 142793507
5-(5-hydroxypentyl)-6-(4-methylsulfonylphenyl)-8,9-dihydro-7H-benzo[7]annulen-4-ol (PubChem CID 142793507) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is 5-(5-hydroxypentyl)-6-(4-methylsulfonylphenyl)-8,9-dihydro-7H-benzo[7]annulen-4-ol.
| Compound Name | 5-(5-hydroxypentyl)-6-(4-methylsulfonylphenyl)-8,9-dihydro-7H-benzo[7]annulen-4-ol |
|---|---|
| PubChem CID | 142793507 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 5-(5-hydroxypentyl)-6-(4-methylsulfonylphenyl)-8,9-dihydro-7H-benzo[7]annulen-4-ol |
| SMILES | CS(=O)(=O)c1ccc(C2=C(CCCCCO)c3c(O)cccc3CCC2)cc1 |
| InChI | InChI=1S/C23H28O4S/c1-28(26,27)19-14-12-17(13-15-19)20-10-5-7-18-8-6-11-22(25)23(18)21(20)9-3-2-4-16-24/h6,8,11-15,24-25H,2-5,7,9-10,16H2,1H3 |
| InChIKey | PCBMVMUASMQRCE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|