C21H26O2S2 — CID 142976619
1-[2-[(3E,5E)-6-methylsulfanylocta-3,5,7-trien-3-yl]cyclopenten-1-yl]-4-methylsulfonylbenzene (PubChem CID 142976619) has the molecular formula C21H26O2S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[2-[(3E,5E)-6-methylsulfanylocta-3,5,7-trien-3-yl]cyclopenten-1-yl]-4-methylsulfonylbenzene.
| Compound Name | 1-[2-[(3E,5E)-6-methylsulfanylocta-3,5,7-trien-3-yl]cyclopenten-1-yl]-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 142976619 |
| Molecular Formula | C21H26O2S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[2-[(3E,5E)-6-methylsulfanylocta-3,5,7-trien-3-yl]cyclopenten-1-yl]-4-methylsulfonylbenzene |
| SMILES | C=C/C(=C\C=C(/CC)C1=C(c2ccc(S(C)(=O)=O)cc2)CCC1)SC |
| InChI | InChI=1S/C21H26O2S2/c1-5-16(10-13-18(6-2)24-3)20-8-7-9-21(20)17-11-14-19(15-12-17)25(4,22)23/h6,10-15H,2,5,7-9H2,1,3-4H3/b16-10+,18-13+ |
| InChIKey | GQQMVKJDYGDCPF-VYPRHBPGSA-N |
| XLogP | 5.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|