C41H81NO2 — CID 87084301
N,N-dimethyl-1,2-bis[(Z)-octadec-9-enoxy]propan-1-amine (PubChem CID 87084301) has the molecular formula C41H81NO2 and a molecular weight of 620.10 g/mol. Its IUPAC name is N,N-dimethyl-1,2-bis[(Z)-octadec-9-enoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-1,2-bis[(Z)-octadec-9-enoxy]propan-1-amine |
|---|---|
| PubChem CID | 87084301 |
| Molecular Formula | C41H81NO2 |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 619.63 |
| IUPAC Name | N,N-dimethyl-1,2-bis[(Z)-octadec-9-enoxy]propan-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(C)C(OCCCCCCCC/C=C\CCCCCCCC)N(C)C |
| InChI | InChI=1S/C41H81NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-43-40(3)41(42(4)5)44-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,40-41H,6-19,24-39H2,1-5H3/b22-20-,23-21- |
| InChIKey | MAFHEURJBRFHIT-YEUCEMRASA-N |
| XLogP | 13.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|