C11H22N2 — CID 87095781
N'-methyl-N'-octa-4,7-dienylethane-1,2-diamine (PubChem CID 87095781) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N'-methyl-N'-octa-4,7-dienylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-octa-4,7-dienylethane-1,2-diamine |
|---|---|
| PubChem CID | 87095781 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N'-methyl-N'-octa-4,7-dienylethane-1,2-diamine |
| SMILES | C=CCC=CCCCN(C)CCN |
| InChI | InChI=1S/C11H22N2/c1-3-4-5-6-7-8-10-13(2)11-9-12/h3,5-6H,1,4,7-12H2,2H3 |
| InChIKey | FUUDMLQBSXVSLG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|