C22H35N3O5S — CID 87099146
1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-amine;tert-butyl N-(4-amino-4-sulfanylidenebutyl)carbamate (PubChem CID 87099146) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is 1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-amine;tert-butyl N-(4-amino-4-sulfanylidenebutyl)carbamate.
| Compound Name | 1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-amine;tert-butyl N-(4-amino-4-sulfanylidenebutyl)carbamate |
|---|---|
| PubChem CID | 87099146 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1,3-bis(prop-2-ynoxy)-2-(prop-2-ynoxymethyl)propan-2-amine;tert-butyl N-(4-amino-4-sulfanylidenebutyl)carbamate |
| SMILES | C#CCOCC(N)(COCC#C)COCC#C.CC(C)(C)OC(=O)NCCCC(N)=S |
| InChI | InChI=1S/C13H17NO3.C9H18N2O2S/c1-4-7-15-10-13(14,11-16-8-5-2)12-17-9-6-3;1-9(2,3)13-8(12)11-6-4-5-7(10)14/h1-3H,7-12,14H2;4-6H2,1-3H3,(H2,10,14)(H,11,12) |
| InChIKey | LNRBPCVVONJHJR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|