About (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane
(2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane (PubChem CID 87102515) has the molecular formula C25H38Si2
and a molecular weight of 394.75 g/mol. Its IUPAC name is (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane |
| PubChem CID | 87102515 |
| Molecular Formula | C25H38Si2 |
| Molecular Weight | 394.75 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane |
| SMILES | CCCCC1(C)C=C2C=c3cc(C)c([Si](C)(C)C)cc3=C2C=C1[Si](C)(C)C |
| InChI | InChI=1S/C25H38Si2/c1-10-11-12-25(3)17-20-14-19-13-18(2)23(26(4,5)6)15-21(19)22(20)16-24(25)27(7,8)9/h13-17H,10-12H2,1-9H3 |
| InChIKey | PSWAATFVPJBJIH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.75 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane?
The IUPAC name of (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane (CID 87102515) is (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane.
What is the SMILES notation for (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane?
The canonical SMILES for (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane is CCCCC1(C)C=C2C=c3cc(C)c([Si](C)(C)C)cc3=C2C=C1[Si](C)(C)C.
What is the InChIKey of (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane?
The InChIKey is PSWAATFVPJBJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38Si2/c1-10-11-12-25(3)17-20-14-19-13-18(2)23(26(4,5)6)15-21(19)22(20)16-24(25)27(7,8)9/h13-17H,10-12H2,1-9H3.
What are the key properties of (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane?
(2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane has a molecular weight of 394.75 g/mol, XLogP of 5.43, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butyl-2,7-dimethyl-6-trimethylsilylfluoren-3-yl)-trimethylsilane is sourced from PubChem (CID 87102515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).