C13H7N — CID 87104537
3-azatetracyclo[7.5.0.02,6.012,14]tetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 87104537) has the molecular formula C13H7N and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-azatetracyclo[7.5.0.02,6.012,14]tetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 3-azatetracyclo[7.5.0.02,6.012,14]tetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 87104537 |
| Molecular Formula | C13H7N |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 3-azatetracyclo[7.5.0.02,6.012,14]tetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1cc2ccc3ccc4cc4c3c2n1 |
| InChI | InChI=1S/C13H7N/c1-3-9-5-6-14-13(9)12-8(1)2-4-10-7-11(10)12/h1-7H |
| InChIKey | KTLUMOZOWZSJFC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |