C12H8F3NO3 — CID 87106251
2-[2,2-difluoropent-4-ynoyl(fluoro)amino]benzoic acid (PubChem CID 87106251) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-[2,2-difluoropent-4-ynoyl(fluoro)amino]benzoic acid.
| Compound Name | 2-[2,2-difluoropent-4-ynoyl(fluoro)amino]benzoic acid |
|---|---|
| PubChem CID | 87106251 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-[2,2-difluoropent-4-ynoyl(fluoro)amino]benzoic acid |
| SMILES | C#CCC(F)(F)C(=O)N(F)c1ccccc1C(=O)O |
| InChI | InChI=1S/C12H8F3NO3/c1-2-7-12(13,14)11(19)16(15)9-6-4-3-5-8(9)10(17)18/h1,3-6H,7H2,(H,17,18) |
| InChIKey | HYQMZDMBLUODFJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|