C14H34O5Si4 — CID 87108441
2-methylidene-3-tris(trimethylsilyloxy)silylbutanoic acid (PubChem CID 87108441) has the molecular formula C14H34O5Si4 and a molecular weight of 394.77 g/mol. Its IUPAC name is 2-methylidene-3-tris(trimethylsilyloxy)silylbutanoic acid.
| Compound Name | 2-methylidene-3-tris(trimethylsilyloxy)silylbutanoic acid |
|---|---|
| PubChem CID | 87108441 |
| Molecular Formula | C14H34O5Si4 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-methylidene-3-tris(trimethylsilyloxy)silylbutanoic acid |
| SMILES | C=C(C(=O)O)C(C)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O5Si4/c1-12(14(15)16)13(2)23(17-20(3,4)5,18-21(6,7)8)19-22(9,10)11/h13H,1H2,2-11H3,(H,15,16) |
| InChIKey | GAXGJYALAOFOGH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|