C9H14F6N2O5 — CID 87113929
(3R,4R)-4-methoxypyrrolidin-3-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87113929) has the molecular formula C9H14F6N2O5 and a molecular weight of 344.21 g/mol. Its IUPAC name is (3R,4R)-4-methoxypyrrolidin-3-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,4R)-4-methoxypyrrolidin-3-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87113929 |
| Molecular Formula | C9H14F6N2O5 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (3R,4R)-4-methoxypyrrolidin-3-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CO[C@@H]1CNC[C@H]1N.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H12N2O.2C2HF3O2/c1-8-5-3-7-2-4(5)6;2*3-2(4,5)1(6)7/h4-5,7H,2-3,6H2,1H3;2*(H,6,7)/t4-,5-;;/m1../s1 |
| InChIKey | ONJPCCYZCFWACJ-ALUAXPQUSA-N |
| XLogP | 0.20 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |