C7H17BF4N2 — CID 87115116
1,2,3-trimethyl-1,3-diazinan-1-ium tetrafluoroborate (PubChem CID 87115116) has the molecular formula C7H17BF4N2 and a molecular weight of 216.03 g/mol. Its IUPAC name is 1,2,3-trimethyl-1,3-diazinan-1-ium tetrafluoroborate.
| Compound Name | 1,2,3-trimethyl-1,3-diazinan-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87115116 |
| Molecular Formula | C7H17BF4N2 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1,2,3-trimethyl-1,3-diazinan-1-ium tetrafluoroborate |
| SMILES | CC1N(C)CCC[NH+]1C.F[B-](F)(F)F |
| InChI | InChI=1S/C7H16N2.BF4/c1-7-8(2)5-4-6-9(7)3;2-1(3,4)5/h7H,4-6H2,1-3H3;/q;-1/p+1 |
| InChIKey | KNTRPULBOIJLMN-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|