C7H17FN2 — CID 67177762
1-ethyl-2,3-dimethylimidazolidin-1-ium fluoride (PubChem CID 67177762) has the molecular formula C7H17FN2 and a molecular weight of 148.23 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazolidin-1-ium fluoride.
| Compound Name | 1-ethyl-2,3-dimethylimidazolidin-1-ium fluoride |
|---|---|
| PubChem CID | 67177762 |
| Molecular Formula | C7H17FN2 |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazolidin-1-ium fluoride |
| SMILES | CC[NH+]1CCN(C)C1C.[F-] |
| InChI | InChI=1S/C7H16N2.FH/c1-4-9-6-5-8(3)7(9)2;/h7H,4-6H2,1-3H3;1H |
| InChIKey | AMUAFBXGWJBAKD-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |