C4H10N+ — CID 59383272
1,2-dimethylaziridin-1-ium (PubChem CID 59383272) has the molecular formula C4H10N+ and a molecular weight of 72.13 g/mol. Its IUPAC name is 1,2-dimethylaziridin-1-ium.
| Compound Name | 1,2-dimethylaziridin-1-ium |
|---|---|
| PubChem CID | 59383272 |
| Molecular Formula | C4H10N+ |
| Molecular Weight | 72.13 g/mol |
| Exact Mass | 72.08 |
| IUPAC Name | 1,2-dimethylaziridin-1-ium |
| SMILES | CC1C[NH+]1C |
| InChI | InChI=1S/C4H9N/c1-4-3-5(4)2/h4H,3H2,1-2H3/p+1 |
| InChIKey | LDUKCCKFNKIVMS-UHFFFAOYSA-O |
| XLogP | -1.10 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 72.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|