C6H14N+ — CID 163413657
1,2,3-trimethylazetidin-1-ium (PubChem CID 163413657) has the molecular formula C6H14N+ and a molecular weight of 100.19 g/mol. Its IUPAC name is 1,2,3-trimethylazetidin-1-ium.
| Compound Name | 1,2,3-trimethylazetidin-1-ium |
|---|---|
| PubChem CID | 163413657 |
| Molecular Formula | C6H14N+ |
| Molecular Weight | 100.19 g/mol |
| Exact Mass | 100.11 |
| IUPAC Name | 1,2,3-trimethylazetidin-1-ium |
| SMILES | CC1C[NH+](C)C1C |
| InChI | InChI=1S/C6H13N/c1-5-4-7(3)6(5)2/h5-6H,4H2,1-3H3/p+1 |
| InChIKey | ACPFWOWRQMPDDM-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |