C8H18NO+ — CID 7201099
(2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-ol (PubChem CID 7201099) has the molecular formula C8H18NO+ and a molecular weight of 144.24 g/mol. Its IUPAC name is (2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-ol.
| Compound Name | (2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7201099 |
| Molecular Formula | C8H18NO+ |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (2S,4R,5R)-1,2,5-trimethylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1C[NH+](C)[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C8H17NO/c1-6-5-9(3)7(2)4-8(6)10/h6-8,10H,4-5H2,1-3H3/p+1/t6-,7+,8-/m1/s1 |
| InChIKey | ZMPIXCGEZCZGGJ-GJMOJQLCSA-O |
| XLogP | -0.71 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |