C11H18O — CID 163493450
4-cycloprop-2-en-1-yl-2,5-dimethylcyclohexan-1-ol (PubChem CID 163493450) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-cycloprop-2-en-1-yl-2,5-dimethylcyclohexan-1-ol.
| Compound Name | 4-cycloprop-2-en-1-yl-2,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 163493450 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-cycloprop-2-en-1-yl-2,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C2C=C2)C(C)CC1O |
| InChI | InChI=1S/C11H18O/c1-7-6-11(12)8(2)5-10(7)9-3-4-9/h3-4,7-12H,5-6H2,1-2H3 |
| InChIKey | COOMNXVRCOGNKA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|