C8H16NO+ — CID 7201180
(2S,5R)-1,2,5-trimethylpiperidin-1-ium-3-one (PubChem CID 7201180) has the molecular formula C8H16NO+ and a molecular weight of 142.22 g/mol. Its IUPAC name is (2S,5R)-1,2,5-trimethylpiperidin-1-ium-3-one.
| Compound Name | (2S,5R)-1,2,5-trimethylpiperidin-1-ium-3-one |
|---|---|
| PubChem CID | 7201180 |
| Molecular Formula | C8H16NO+ |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (2S,5R)-1,2,5-trimethylpiperidin-1-ium-3-one |
| SMILES | C[C@@H]1CC(=O)[C@H](C)[NH+](C)C1 |
| InChI | InChI=1S/C8H15NO/c1-6-4-8(10)7(2)9(3)5-6/h6-7H,4-5H2,1-3H3/p+1/t6-,7+/m1/s1 |
| InChIKey | GRWGTAUEYJUECS-RQJHMYQMSA-O |
| XLogP | -0.50 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |