C10H22NO+ — CID 6984969
(2S,3R,5S)-1,5-dimethyl-2-propan-2-ylpiperidin-1-ium-3-ol (PubChem CID 6984969) has the molecular formula C10H22NO+ and a molecular weight of 172.29 g/mol. Its IUPAC name is (2S,3R,5S)-1,5-dimethyl-2-propan-2-ylpiperidin-1-ium-3-ol.
| Compound Name | (2S,3R,5S)-1,5-dimethyl-2-propan-2-ylpiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 6984969 |
| Molecular Formula | C10H22NO+ |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | (2S,3R,5S)-1,5-dimethyl-2-propan-2-ylpiperidin-1-ium-3-ol |
| SMILES | CC(C)[C@H]1[C@H](O)C[C@H](C)C[NH+]1C |
| InChI | InChI=1S/C10H21NO/c1-7(2)10-9(12)5-8(3)6-11(10)4/h7-10,12H,5-6H2,1-4H3/p+1/t8-,9+,10-/m0/s1 |
| InChIKey | HGPVQYXVJIUWJX-AEJSXWLSSA-O |
| XLogP | -0.07 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |