C10H18N3S2+ — CID 7360627
(5S,6R,9R)-6,8,9-trimethyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dithione (PubChem CID 7360627) has the molecular formula C10H18N3S2+ and a molecular weight of 244.41 g/mol. Its IUPAC name is (5S,6R,9R)-6,8,9-trimethyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dithione.
| Compound Name | (5S,6R,9R)-6,8,9-trimethyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dithione |
|---|---|
| PubChem CID | 7360627 |
| Molecular Formula | C10H18N3S2+ |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (5S,6R,9R)-6,8,9-trimethyl-1,3-diaza-8-azoniaspiro[4.5]decane-2,4-dithione |
| SMILES | C[C@@H]1C[C@]2(NC(=S)NC2=S)[C@H](C)C[NH+]1C |
| InChI | InChI=1S/C10H17N3S2/c1-6-5-13(3)7(2)4-10(6)8(14)11-9(15)12-10/h6-7H,4-5H2,1-3H3,(H2,11,12,14,15)/p+1/t6-,7-,10+/m1/s1 |
| InChIKey | OTXJAGKOOBMJGK-XSSZXYGBSA-O |
| XLogP | -0.53 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|