C17H27N2+ — CID 7431930
(2R,4S,5R)-1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-1-ium-4-amine (PubChem CID 7431930) has the molecular formula C17H27N2+ and a molecular weight of 259.42 g/mol. Its IUPAC name is (2R,4S,5R)-1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-1-ium-4-amine.
| Compound Name | (2R,4S,5R)-1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 7431930 |
| Molecular Formula | C17H27N2+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | (2R,4S,5R)-1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-1-ium-4-amine |
| SMILES | C=CC[C@]1(Nc2ccccc2)C[C@@H](C)[NH+](C)C[C@H]1C |
| InChI | InChI=1S/C17H26N2/c1-5-11-17(18-16-9-7-6-8-10-16)12-15(3)19(4)13-14(17)2/h5-10,14-15,18H,1,11-13H2,2-4H3/p+1/t14-,15-,17+/m1/s1 |
| InChIKey | VNEVZWHHGRSVRH-INMHGKMJSA-O |
| XLogP | 2.36 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|