C14H8O2S3 — CID 87118157
2-(5-thiophen-2-ylthiophen-2-yl)thiophene-3,4-dicarbaldehyde (PubChem CID 87118157) has the molecular formula C14H8O2S3 and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-(5-thiophen-2-ylthiophen-2-yl)thiophene-3,4-dicarbaldehyde.
| Compound Name | 2-(5-thiophen-2-ylthiophen-2-yl)thiophene-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 87118157 |
| Molecular Formula | C14H8O2S3 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2-(5-thiophen-2-ylthiophen-2-yl)thiophene-3,4-dicarbaldehyde |
| SMILES | O=Cc1csc(-c2ccc(-c3cccs3)s2)c1C=O |
| InChI | InChI=1S/C14H8O2S3/c15-6-9-8-18-14(10(9)7-16)13-4-3-12(19-13)11-2-1-5-17-11/h1-8H |
| InChIKey | FNQWFMIJKBZBOU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|