About Copper acetylmethionate
Copper acetylmethionate (PubChem CID 87120525) has the molecular formula C14H24CuN2O6S2
and a molecular weight of 444.00 g/mol. Its IUPAC name is copper bis((2S)-2-acetamido-4-methylsulfanylbutanoate).
Molecular Properties
| Compound Name | Copper acetylmethionate |
| PubChem CID | 87120525 |
| Molecular Formula | C14H24CuN2O6S2 |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | copper bis((2S)-2-acetamido-4-methylsulfanylbutanoate) |
| SMILES | CC(=O)N[C@@H](CCSC)C(=O)[O-].CC(=O)N[C@@H](CCSC)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C7H13NO3S.Cu/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1 |
| InChIKey | OBNKJIPLLQKPCM-UAIGZDOSSA-L |
| XLogP | — |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | 167 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Copper acetylmethionate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Copper acetylmethionate?
The IUPAC name of Copper acetylmethionate (CID 87120525) is copper bis((2S)-2-acetamido-4-methylsulfanylbutanoate).
What is the SMILES notation for Copper acetylmethionate?
The canonical SMILES for Copper acetylmethionate is CC(=O)N[C@@H](CCSC)C(=O)[O-].CC(=O)N[C@@H](CCSC)C(=O)[O-].[Cu+2].
What is the InChIKey of Copper acetylmethionate?
The InChIKey is OBNKJIPLLQKPCM-UAIGZDOSSA-L. The full InChI is InChI=1S/2C7H13NO3S.Cu/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1.
What are the key properties of Copper acetylmethionate?
Copper acetylmethionate has a molecular weight of 444.00 g/mol, XLogP of not available, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Copper acetylmethionate is sourced from PubChem (CID 87120525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).