C16H24BrN3 — CID 87121308
3-(3-benzylimidazol-3-ium-1-yl)-N,N,2-trimethylpropan-1-amine bromide (PubChem CID 87121308) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-(3-benzylimidazol-3-ium-1-yl)-N,N,2-trimethylpropan-1-amine bromide.
| Compound Name | 3-(3-benzylimidazol-3-ium-1-yl)-N,N,2-trimethylpropan-1-amine bromide |
|---|---|
| PubChem CID | 87121308 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-(3-benzylimidazol-3-ium-1-yl)-N,N,2-trimethylpropan-1-amine bromide |
| SMILES | CC(CN(C)C)Cn1cc[n+](Cc2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C16H24N3.BrH/c1-15(11-17(2)3)12-18-9-10-19(14-18)13-16-7-5-4-6-8-16;/h4-10,14-15H,11-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IIJORMJCKVPSBH-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|